Inquiry Basket
IUPAC Name | |
---|---|
IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-nitro-1,2,4-triazole |
Synonyms | |
Synonyms | TSNT; 3-Nitro-1-tosyl-1H-1,2,4-triazole; J-503610 |
Appearance | |
Appearance | Off-white to Light Yellow Crystalline |
Purity | |
Purity | 98% |
Melting Point | |
Melting Point | 133-135 °C |
Storage | |
Storage | RT |
InChI | |
InChI | InChI=1S/C9H8N4O4S/c1-7-2-4-8(5-3-7)18(16,17)12-6-10-9(11-12)13(14)15/h2-6H,1H3 |
InChI Key | |
InChI Key | ZQMJAWSQRGYFBM-UHFFFAOYSA-N |
Canonical SMILES | |
Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=NC(=N2)[N+](=O)[O-] |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2