Inquiry Basket
A sulfhydryl and amino reactive heterobifunctional protein crosslinking reagent.
| IUPAC Name | |
|---|---|
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-iodoacetate |
| Synonyms | |
| Synonyms | N-Succinimidyl Iodoacetate; N-Iodoacetoxysuccinimide; N-Hydroxysuccinimidyl Iodoacetate; N-Hydroxysuccinimide Iodoacetic Acid Ester; SIA Crosslinker; Succinimidyl iodoacetate; 1-[(Iodoacetyl)oxy]pyrrolidine-2,5-dione; SCHEMBL43673; BICL214; CTK8B3659 |
| Appearance | |
| Appearance | Light Yellow to White Crystal Powder |
| Purity | |
| Purity | 95% (HNMR) |
| Density | |
| Density | 2.110±0.10 g/cm3 (Predicted) |
| Melting Point | |
| Melting Point | 148 °C |
| Boiling Point | |
| Boiling Point | 315.6±44.0 °C (Predicted) |
| Storage | |
| Storage | -20 °C under inert atmosphere |
| Solubility | |
| Solubility | Soluble in DMF (50 mg/mL), Chloroform, Dichloromethane, Ethyl Acetate |
| InChI | |
| InChI | InChI=1S/C6H6INO4/c7-3-6(11)12-8-4(9)1-2-5(8)10/h1-3H2 |
| InChI Key | |
| InChI Key | VRDGQQTWSGDXCU-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)CI |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
