Inquiry Basket
A sulfhydryl and amino reactive heterobifunctional protein crosslinking reagent.
IUPAC Name | |
---|---|
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-iodoacetate |
Synonyms | |
Synonyms | N-Succinimidyl Iodoacetate; N-Iodoacetoxysuccinimide; N-Hydroxysuccinimidyl Iodoacetate; N-Hydroxysuccinimide Iodoacetic Acid Ester; SIA Crosslinker; Succinimidyl iodoacetate; 1-[(Iodoacetyl)oxy]pyrrolidine-2,5-dione; SCHEMBL43673; BICL214; CTK8B3659 |
Appearance | |
Appearance | Light Yellow to White Crystal Powder |
Purity | |
Purity | 95% (HNMR) |
Density | |
Density | 2.110±0.10 g/cm3 (Predicted) |
Melting Point | |
Melting Point | 148 °C |
Boiling Point | |
Boiling Point | 315.6±44.0 °C (Predicted) |
Storage | |
Storage | -20 °C under inert atmosphere |
Solubility | |
Solubility | Soluble in DMF (50 mg/mL), Chloroform, Dichloromethane, Ethyl Acetate |
InChI | |
InChI | InChI=1S/C6H6INO4/c7-3-6(11)12-8-4(9)1-2-5(8)10/h1-3H2 |
InChI Key | |
InChI Key | VRDGQQTWSGDXCU-UHFFFAOYSA-N |
Canonical SMILES | |
Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)CI |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2