Inquiry Basket
3,3-Diphenyl-L-alanine is used in the making of l-Diphenylalanine Microtubes that functions as a potential drug delivery systems.
Synonyms | |
---|---|
Synonyms | L-Ala(3,3-diphenyl)-OH; (S)-2-Amino-3,3-diphenylpropionic acid; L-3,3-Diphenylalanine; L-Phenylalanine, beta-phenyl-; 3,3-Diphenylalanine; beta-Phenylphenylalanine; beta-Phenyl-L-phenylalanine; (2S)-2-amino-3,3-diphenylpropanoic acid |
Appearance | |
Appearance | White powder |
Purity | |
Purity | ≥ 99% |
Density | |
Density | 1.198±0.06 g/cm3 (Predicted) |
Melting Point | |
Melting Point | 234-240 °C |
Boiling Point | |
Boiling Point | 389.2±30.0 °C (Predicted) |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C15H15NO2/c16-14(15(17)18)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H,16H2,(H,17,18)/t14-/m0/s1 |
InChI Key | |
InChI Key | PECGVEGMRUZOML-AWEZNQCLSA-N |
Canonical SMILES | |
Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(C(=O)O)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2