Inquiry Basket
3,3-Diphenyl-L-alanine is used in the making of l-Diphenylalanine Microtubes that functions as a potential drug delivery systems.
| Synonyms | |
|---|---|
| Synonyms | L-Ala(3,3-diphenyl)-OH; (S)-2-Amino-3,3-diphenylpropionic acid; L-3,3-Diphenylalanine; L-Phenylalanine, beta-phenyl-; 3,3-Diphenylalanine; beta-Phenylphenylalanine; beta-Phenyl-L-phenylalanine; (2S)-2-amino-3,3-diphenylpropanoic acid |
| Appearance | |
| Appearance | White powder |
| Purity | |
| Purity | ≥ 99% |
| Density | |
| Density | 1.198±0.06 g/cm3 (Predicted) |
| Melting Point | |
| Melting Point | 234-240 °C |
| Boiling Point | |
| Boiling Point | 389.2±30.0 °C (Predicted) |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C15H15NO2/c16-14(15(17)18)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H,16H2,(H,17,18)/t14-/m0/s1 |
| InChI Key | |
| InChI Key | PECGVEGMRUZOML-AWEZNQCLSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(C(=O)O)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
