3-Amino-4-iodobenzoic acid (BAT-010904)

Category
Other Unnatural Amino Acids
Catalog number
BAT-010904
CAS number
51411-81-5
Molecular Formula
C7H6INO2
Molecular Weight
263.03
3-Amino-4-iodobenzoic acid
IUPAC Name
3-amino-4-iodobenzoic acid
Synonyms
4-iodo-3-aminobenzoic acid
InChI
InChI=1S/C7H6INO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,9H2,(H,10,11)
InChI Key
MLHDNXRHJMQUOY-UHFFFAOYSA-N
Canonical SMILES
C1=CC(=C(C=C1C(=O)O)N)I
Bio Calculators
Stock concentration: *
Desired final volume: *
Desired concentration: *

L

* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2

* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O c22h30n40
g/mol
g
Quick Inquiry
Verification code
Inquiry Basket