Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | DL-Phe(4-NH2)-OH; p-Amino-DL-phenylalanine; 2-Amino-3-(4-aminophenyl)propanoic acid; 4-Amino-dl-phenylalanine; H-DL-Phe(4-NH2)-OH; p-Amino-dl-phenylalanine; 4-Aminophenylalanine; H-p-Amino-Phe-OH HCl; Phenylalanine, 4-amino-; p-AMINOPHENYL ALANINE; H-P-AMINO-DL-PHE-OH HYDRATE; para-Aminophenylalanine; L-2-Amino-3-(4-aminophenyl)propanoic acid; Dl-(4-Amino)-Phenylalanine; p-Amino-D-phenylalanine acid; DL-4-NH2-Phe-OH |
| Appearance | |
| Appearance | White to off-white solid |
| Purity | |
| Purity | ≥ 97% (HPLC) |
| Density | |
| Density | 1.289 g/cm3 |
| Melting Point | |
| Melting Point | 255-258 °C (dec.) |
| Boiling Point | |
| Boiling Point | 383.5 °C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C9H12N2O2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,10-11H2,(H,12,13) |
| InChI Key | |
| InChI Key | CMUHFUGDYMFHEI-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC(=CC=C1CC(C(=O)O)N)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
