Methyl 6-iodopicolinate (BAT-008900)
* For research use only

Category
Cyclic Amino Acids
Catalog number
BAT-008900
CAS number
849830-15-5
Molecular Formula
C7H6INO2
Molecular Weight
263.03
Methyl 6-iodopicolinate
IUPAC Name
methyl 6-iodopyridine-2-carboxylate
Synonyms
6-Iodo-pyridine-2-carboxylic acid methyl ester; 6-Iodopyridine-2-carboxylic acid methyl ester
InChI
InChI=1S/C7H6INO2/c1-11-7(10)5-3-2-4-6(8)9-5/h2-4H,1H3
InChI Key
GUTYNFXCTKHUAX-UHFFFAOYSA-N
Canonical SMILES
COC(=O)C1=NC(=CC=C1)I
Bio Calculators
Stock concentration: *
Desired final volume: *
Desired concentration: *

L

* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2

* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O c22h30n40
g/mol
g
Quick Inquiry
Verification code
Inquiry Basket