Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | Boc-D-Phe(4-CN)-OH; Boc-p-cyano-D-Phe-OH; (R)-Boc-2-amino-(4-cyanophenyl)propanoic acid |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 100% (HPLC) |
| Density | |
| Density | 1.22 g/cm3 |
| Melting Point | |
| Melting Point | 154-157 °C |
| Boiling Point | |
| Boiling Point | 494°C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C15H18N2O4/c1-15(2,3)21-14(20)17-12(13(18)19)8-10-4-6-11(9-16)7-5-10/h4-7,12H,8H2,1-3H3,(H,17,20)(H,18,19)/t12-/m1/s1 |
| InChI Key | |
| InChI Key | RMBLTLXJGNILPG-GFCCVEGCSA-N |
| Canonical SMILES | |
| Canonical SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)C#N)C(=O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
