Inquiry Basket
Synonyms | |
---|---|
Synonyms | Boc-L-Chg-OH; Boc-cyclohexyl-L-Gly-OH; (S)-tert-Butoxycarbonylamino-cyclohexyl-acetic acid; Boc L Chg OH |
Appearance | |
Appearance | White to off-white powder |
Purity | |
Purity | ≥ 99% (HPLC) |
Density | |
Density | 1.111 g/cm3 |
Melting Point | |
Melting Point | 94-96 °C |
Boiling Point | |
Boiling Point | 407.9°C at 760 mmHg |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C13H23NO4/c1-13(2,3)18-12(17)14-10(11(15)16)9-7-5-4-6-8-9/h9-10H,4-8H2,1-3H3,(H,14,17)(H,15,16)/t10-/m0/s1 |
InChI Key | |
InChI Key | QSUXZIPXYDQFCX-JTQLQIEISA-N |
Canonical SMILES | |
Canonical SMILES | CC(C)(C)OC(=O)NC(C1CCCCC1)C(=O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2