Inquiry Basket
Synonyms | |
---|---|
Synonyms | Boc-L-Pro-NH2; (S)-Boc-pyrrolidine-2-carboxylic acid amide |
Appearance | |
Appearance | White to off-white powder |
Purity | |
Purity | ≥ 99% (HPLC) |
Density | |
Density | 1.155±0.06 g/cm3(Predicted) |
Melting Point | |
Melting Point | 105-110 °C |
Boiling Point | |
Boiling Point | 370.1±31.0 °C(Predicted) |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C10H18N2O3/c1-10(2,3)15-9(14)12-6-4-5-7(12)8(11)13/h7H,4-6H2,1-3H3,(H2,11,13)/t7-/m0/s1 |
InChI Key | |
InChI Key | PITJAAIPVBVRAO-ZETCQYMHSA-N |
Canonical SMILES | |
Canonical SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2