Inquiry Basket
Synonyms | |
---|---|
Synonyms | Boc-L-Hyp-OtBu; Boc L Hyp OtBu |
Appearance | |
Appearance | White to off-white solid |
Purity | |
Purity | ≥ 95% (Assay) |
Density | |
Density | 1.144 g/cm3 |
Melting Point | |
Melting Point | 62-64 °C |
Boiling Point | |
Boiling Point | 369.1°C at 760 mmHg |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C14H25NO5/c1-13(2,3)19-11(17)10-7-9(16)8-15(10)12(18)20-14(4,5)6/h9-10,16H,7-8H2,1-6H3/t9-,10+/m1/s1 |
InChI Key | |
InChI Key | OXHIVNUWGSCHBD-ZJUUUORDSA-N |
Canonical SMILES | |
Canonical SMILES | CC(C)(C)OC(=O)C1CC(CN1C(=O)OC(C)(C)C)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2