Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | Boc-L-Hyp-OtBu; Boc L Hyp OtBu |
| Appearance | |
| Appearance | White to off-white solid |
| Purity | |
| Purity | ≥ 95% (Assay) |
| Density | |
| Density | 1.144 g/cm3 |
| Melting Point | |
| Melting Point | 62-64 °C |
| Boiling Point | |
| Boiling Point | 369.1°C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C14H25NO5/c1-13(2,3)19-11(17)10-7-9(16)8-15(10)12(18)20-14(4,5)6/h9-10,16H,7-8H2,1-6H3/t9-,10+/m1/s1 |
| InChI Key | |
| InChI Key | OXHIVNUWGSCHBD-ZJUUUORDSA-N |
| Canonical SMILES | |
| Canonical SMILES | CC(C)(C)OC(=O)C1CC(CN1C(=O)OC(C)(C)C)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
