Inquiry Basket
Synonyms | |
---|---|
Synonyms | Boc-L-Val-OH; N-(tert-Butoxycarbonyl)-L-valine; tert-Butoxycarbonylvaline |
Appearance | |
Appearance | White to off-white powder |
Purity | |
Purity | 98.5-101.0% (Assay by titration) |
Density | |
Density | 1.1518 g/cm3(rough estimate) |
Melting Point | |
Melting Point | 71-84 °C |
Boiling Point | |
Boiling Point | 357.82°C (rough estimate) |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C10H19NO4/c1-6(2)7(8(12)13)11-9(14)15-10(3,4)5/h6-7H,1-5H3,(H,11,14)(H,12,13)/t7-/m0/s1 |
InChI Key | |
InChI Key | SZXBQTSZISFIAO-ZETCQYMHSA-N |
Canonical SMILES | |
Canonical SMILES | CC(C)C(C(=O)O)NC(=O)OC(C)(C)C |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2