Inquiry Basket
| IUPAC Name | |
|---|---|
| IUPAC Name | (2R)-3-(4-acetylphenyl)-2-aminopropanoic acid |
| Synonyms | |
| Synonyms | H-D-Phe(4-Ac)-OH; (R)-2-Amino-3-(4-acetylphenyl)propionic acid; D-4-Acetylphenylalanine |
| Appearance | |
| Appearance | Pale white Solid |
| Purity | |
| Purity | ≥ 98% by Chiral HPLC |
| Density | |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | |
| Boiling Point | 396.7±37.0 °C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C11H13NO3/c1-7(13)9-4-2-8(3-5-9)6-10(12)11(14)15/h2-5,10H,6,12H2,1H3,(H,14,15)/t10-/m1/s1 |
| InChI Key | |
| InChI Key | ZXSBHXZKWRIEIA-SNVBAGLBSA-N |
| Canonical SMILES | |
| Canonical SMILES | CC(=O)C1=CC=C(C=C1)CC(C(=O)O)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
Three to One Letter Converter: Pull down the menu to view the 3 to 1 conversion.
Enter Peptide Sequence in Box (use one letter code)
Length: Residues
Molecular Weight: g/mol
Molecular formula:
