Inquiry Basket
D-Histidine methyl ester is a protected form of D-Histidine. D-Histidine is the unnatural, biologically inactive isomer of L-Histidine. D-histidine is known to inhibit cell division, and is also used by certain types of bacteria (such as Escherichia coli) as a source of L-Histidine.
| Synonyms | |
|---|---|
| Synonyms | D-Histidine methyl ester dihydrochloride; (R)-methyl 2-amino-3-(1H-imidazol-4-yl)propanoate dihydrochloride; H-D-His-OMe 2HCl; D-HISTIDINE METHYLESTER DIHYDROCHLORIDE; H-D-His-OMe 2HCl; methyl (2R)-2-amino-3-(1H-imidazol-5-yl)propanoate dihydrochloride; H D His OMe 2HCl |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 98% (HPLC) |
| Melting Point | |
| Melting Point | 208-212 °C (dec) |
| Boiling Point | |
| Boiling Point | 415.4 °C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C7H11N3O2.2ClH/c1-12-7(11)6(8)2-5-3-9-4-10-5;;/h3-4,6H,2,8H2,1H3,(H,9,10);2*1H/t6-;;/m1../s1 |
| InChI Key | |
| InChI Key | DWAYENIPKPKKMV-QYCVXMPOSA-N |
| Canonical SMILES | |
| Canonical SMILES | COC(=O)C(CC1=CN=CN1)N.Cl.Cl |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
