Inquiry Basket
D-(+)-Phenyllactic acid, an antibacterial agent excreted by Geotrichum candidum, inhibits a range of gram-positive bacteria in humans and foodstuffs as well as gram-negative bacteria found in humans.
| IUPAC Name | |
|---|---|
| IUPAC Name | (2R)-2-hydroxy-3-phenylpropanoic acid |
| Synonyms | |
| Synonyms | D-3-Phenyllactic acid; D-(+)-3-Phenyllactic Acid; (+)-2-Hydroxy-3-phenylpropanoic Acid; (+)-2-Hydroxy-3-phenylpropionic Acid; (+)-β-Phenyllactic Acid; (2R)-2-Hydroxy-3-phenylpropionic Acid; (2R)-3-Phenyl-2-hydroxypropanoic Acid; (R)-2-Hydroxy-3-phenylpropionic Acid; (R)-3-Phenyl-2-hydroxypropanoic Acid; (R)-3-Phenyl-2-hydroxypropionic Acid; (R)-3-Phenyllactic Acid; (R)-Phenyllactic Acid; (R)-α-Hydroxy-3-phenylpropionic Acid; (R)-β-Phenyllactic Acid; D-2-Hydroxy-3-phenylpropionic Acid; D-β-Phenyllactic Acid; β-Phenyl-D-lactic Acid |
| Related CAS | |
| Related CAS | 20312-36-1 (L-isomer) |
| Appearance | |
| Appearance | Off-white Solid |
| Purity | |
| Purity | ≥95% |
| Density | |
| Density | 1.3±0.1 g/cm3 |
| Melting Point | |
| Melting Point | 121-125°C |
| Boiling Point | |
| Boiling Point | 331.6±22.0°C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8°C |
| Solubility | |
| Solubility | Soluble in Acetone (Slightly), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| InChI | |
| InChI | InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m1/s1 |
| InChI Key | |
| InChI Key | VOXXWSYKYCBWHO-MRVPVSSYSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
Three to One Letter Converter: Pull down the menu to view the 3 to 1 conversion.
Enter Peptide Sequence in Box (use one letter code)
Length: Residues
Molecular Weight: g/mol
Molecular formula:
