Inquiry Basket
Synonyms | |
---|---|
Synonyms | D-Ser-OBzl HCl; D-b-Hydroxyalanine benzyl ester hydrochloride; (R)-Benzyl 2-amino-3-hydroxypropanoate hydrochloride |
Appearance | |
Appearance | White to off white powder |
Purity | |
Purity | ≥ 99% (HPLC) |
Melting Point | |
Melting Point | 169-174 °C |
Boiling Point | |
Boiling Point | 360.4ºC at 760 mmHg |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C10H13NO3.ClH/c11-9(6-12)10(13)14-7-8-4-2-1-3-5-8;/h1-5,9,12H,6-7,11H2;1H/t9-;/m1./s1 |
InChI Key | |
InChI Key | MGZWCDQAKCHOBX-SBSPUUFOSA-N |
Canonical SMILES | |
Canonical SMILES | C1=CC=C(C=C1)COC(=O)C(CO)N.Cl |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2