Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | D-Ser-OBzl HCl; D-b-Hydroxyalanine benzyl ester hydrochloride; (R)-Benzyl 2-amino-3-hydroxypropanoate hydrochloride |
| Appearance | |
| Appearance | White to off white powder |
| Purity | |
| Purity | ≥ 99% (HPLC) |
| Melting Point | |
| Melting Point | 169-174 °C |
| Boiling Point | |
| Boiling Point | 360.4ºC at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C10H13NO3.ClH/c11-9(6-12)10(13)14-7-8-4-2-1-3-5-8;/h1-5,9,12H,6-7,11H2;1H/t9-;/m1./s1 |
| InChI Key | |
| InChI Key | MGZWCDQAKCHOBX-SBSPUUFOSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)C(CO)N.Cl |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
