Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | D-Tyr-OEt HCl; (R)-Ethyl 2-amino-3-(4-hydroxyphenyl)propanoate hydrochloride |
| Appearance | |
| Appearance | Beige to off-white powder |
| Purity | |
| Purity | ≥ 99% (Titration) |
| Density | |
| Density | g/cm3 |
| Melting Point | |
| Melting Point | 166-170 °C |
| Boiling Point | |
| Boiling Point | 373.5ºC at 760 mmHg |
| Storage | |
| Storage | Store at 2-8°C |
| InChI | |
| InChI | InChI=1S/C11H15NO3.ClH/c1-2-15-11(14)10(12)7-8-3-5-9(13)6-4-8;/h3-6,10,13H,2,7,12H2,1H3;1H/t10-;/m1./s1 |
| InChI Key | |
| InChI Key | BQULAXAVRFIAHN-HNCPQSOCSA-N |
| Canonical SMILES | |
| Canonical SMILES | CCOC(=O)C(CC1=CC=C(C=C1)O)N.Cl |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
