Inquiry Basket
Cysteine is a non-essential amino acid that can be synthesized by the human body under normal physiological conditions if a sufficient quantity of methionine is available. Cysteine is commonly used as a precursor in the food and pharmaceutical industries. Cysteine is used as a processing aid for baking, as an additive in cigarettes, as well as in the preparation of meat flavours.
| IUPAC Name | |
|---|---|
| IUPAC Name | 2-amino-3-sulfanylpropanoic acid |
| Synonyms | |
| Synonyms | Cysteine; DL-Cysteine; (+/-)-Cysteine; NSC 63864 |
| Appearance | |
| Appearance | Off-White Solid |
| Purity | |
| Purity | 98% |
| Density | |
| Density | 1.334 g/cm3 |
| Melting Point | |
| Melting Point | >197ºC(dec.) |
| Boiling Point | |
| Boiling Point | 293.9ºC at 760 mmHg |
| Storage | |
| Storage | Store at -20°C Under inert atmosphere |
| Solubility | |
| Solubility | soluble in DMSO, Water |
| InChI | |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
| InChI Key | |
| InChI Key | XUJNEKJLAYXESH-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | C(C(C(=O)O)N)S |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
