Inquiry Basket
DL-Cysteine hydrochloride is used in cosmetics, used for hair treatment contains Cysteamine. It is also order control agent. Used in process for permanent shaping of human hair.
| Synonyms | |
|---|---|
| Synonyms | DL-2-Amino-3-mercaptopropionic acid hydrochloride; 2-Amino-3-sulfanylpropanoic Acid Hydrochloride; (±)-Cysteine Hydrochloride; 2-amino-3-mercaptopropanoic acid hydrochloride; CYSTEINE HYDROCHLORIDE; H-DL-Cys-OH HCl; H DL Cys OH HCl |
| Appearance | |
| Appearance | White solid |
| Purity | |
| Purity | ≥ 95% |
| Density | |
| Density | g/cm3 |
| Melting Point | |
| Melting Point | 109-112 °C |
| Boiling Point | |
| Boiling Point | 293.9 °C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C3H7NO2S.ClH/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);1H |
| InChI Key | |
| InChI Key | IFQSXNOEEPCSLW-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | C(C(C(=O)O)N)S.Cl |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
