Inquiry Basket
Synonyms | |
---|---|
Synonyms | 3-[p-(p-Hydroxyphenoxy)phenyl]-DL-alanine |
Appearance | |
Appearance | Off-white to gray powder |
Purity | |
Purity | ≥ 98% (TLC) |
Density | |
Density | 1.323 g/cm3 |
Boiling Point | |
Boiling Point | 477.7°C at 760 mmHg |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C15H15NO4/c16-14(15(18)19)9-10-1-5-12(6-2-10)20-13-7-3-11(17)4-8-13/h1-8,14,17H,9,16H2,(H,18,19) |
InChI Key | |
InChI Key | KKCIOUWDFWQUBT-UHFFFAOYSA-N |
Canonical SMILES | |
Canonical SMILES | C1=CC(=CC=C1CC(C(=O)O)N)OC2=CC=C(C=C2)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2