Ethyl 5-(4-fluorophenyl)isoxazole-3-carboxylate (BAT-008864)
* For research use only

Category
Cyclic Amino Acids
Catalog number
BAT-008864
CAS number
640291-92-5
Molecular Formula
C12H10FNO3
Molecular Weight
235.21
Ethyl 5-(4-fluorophenyl)isoxazole-3-carboxylate
IUPAC Name
ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate
Synonyms
ethyl 5-(4-fluorophenyl)-1,2-oxazole-3-carboxylate
InChI
InChI=1S/C12H10FNO3/c1-2-16-12(15)10-7-11(17-14-10)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3
InChI Key
IYDBYHCVVNAFSM-UHFFFAOYSA-N
Canonical SMILES
CCOC(=O)C1=NOC(=C1)C2=CC=C(C=C2)F
Bio Calculators
Stock concentration: *
Desired final volume: *
Desired concentration: *

L

* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2

* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O c22h30n40
g/mol
g
Quick Inquiry
Verification code
Inquiry Basket