Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | Fmoc-5-Ava-OH; Fmoc-5-aminopentanoic acid; Fmoc 5 Ava OH |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 99% (HPLC) |
| Density | |
| Density | 1.231 g/cm3 |
| Melting Point | |
| Melting Point | 135-136 °C |
| Boiling Point | |
| Boiling Point | 562.24°C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C20H21NO4/c22-19(23)11-5-6-12-21-20(24)25-13-18-16-9-3-1-7-14(16)15-8-2-4-10-17(15)18/h1-4,7-10,18H,5-6,11-13H2,(H,21,24)(H,22,23) |
| InChI Key | |
| InChI Key | ULLSWWGYZWBPHK-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCC(=O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
