Fmoc-Ala-Cl (BAT-005291)
* For research use only

Category
Fmoc-Amino Acids
Catalog number
BAT-005291
CAS number
103321-50-2
Molecular Formula
C18H16NO3Cl
Molecular Weight
329.78
Fmoc-Ala-Cl
Synonyms
9H-fluoren-9-ylmethyl N-[(2S)-1-chloro-1-oxopropan-2-yl]carbamate; Fmoc-L-alanyl chloride; L-Fmoc-alanine chloride; Fmoc-L-Ala-Cl; Fmoc-alanine chloride
Purity
≧ 95%
InChI
InChI=1S/C18H16ClNO3/c1-11(17(19)21)20-18(22)23-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,11,16H,10H2,1H3,(H,20,22)/t11-/m0/s1
InChI Key
AFMYCMGTXVCJCH-NSHDSACASA-N
Canonical SMILES
CC(C(=O)Cl)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Bio Calculators
Stock concentration: *
Desired final volume: *
Desired concentration: *

L

* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2

* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O c22h30n40
g/mol
g
Quick Inquiry
Verification code
Inquiry Basket