Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | Fmoc-glycyl-glycyl-glycine; 1-(9H-Fluoren-9-Yl)-3,6,9-Trioxo-2-Oxa-4,7,10-Triazadodecan-12-Oic Acid |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 97% (HPLC) |
| Density | |
| Density | 1.354±0.06 g/cm3(Predicted) |
| Boiling Point | |
| Boiling Point | 811.8±65.0 °C(Predicted) |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C21H21N3O6/c25-18(23-11-20(27)28)9-22-19(26)10-24-21(29)30-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,17H,9-12H2,(H,22,26)(H,23,25)(H,24,29)(H,27,28) |
| InChI Key | |
| InChI Key | YUYBSGRVYRPYLB-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)NCC(=O)NCC(=O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
