Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | Fmoc-(S)-azetidine-2-carboxylic acid |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 99% (HPLC) |
| Density | |
| Density | 1.2675 g/cm3 (rou gh estimate) |
| Melting Point | |
| Melting Point | 128-132 ℃ |
| Boiling Point | |
| Boiling Point | 461.82 ℃ (rough estimate) |
| Storage | |
| Storage | Store at 2-8 ℃ |
| InChI | |
| InChI | InChI=1S/C19H17NO4/c21-18(22)17-9-10-20(17)19(23)24-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H,21,22)/t17-/m0/s1 |
| InChI Key | |
| InChI Key | BXRZCDISGRVJCA-KRWDZBQOSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1CN(C1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
