Inquiry Basket
Synonyms | |
---|---|
Synonyms | Glycine, N-[(9H-Fluoren-9-Ylmethoxy)Carbonyl]-L-Phenylalanyl- |
Appearance | |
Appearance | White to off-white powder |
Purity | |
Purity | ≥ 98% (HPLC) |
Density | |
Density | 1.298±0.06 g/cm3(Predicted) |
Melting Point | |
Melting Point | 175-180 °C |
Boiling Point | |
Boiling Point | 760.6±60.0 °C(Predicted) |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C26H24N2O5/c29-24(30)15-27-25(31)23(14-17-8-2-1-3-9-17)28-26(32)33-16-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,22-23H,14-16H2,(H,27,31)(H,28,32)(H,29,30)/t23-/m0/s1 |
InChI Key | |
InChI Key | WJQWIPAQNBOEBX-QHCPKHFHSA-N |
Canonical SMILES | |
Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)NCC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2