Inquiry Basket
Synonyms | |
---|---|
Synonyms | (S)-1-((S)-1-(((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Pyrrolidine-2-Carbonyl)Pyrrolidine-2-Carboxylic Acid |
Appearance | |
Appearance | White to off-white powder |
Purity | |
Purity | ≥ 98% (HPLC) |
Density | |
Density | 1.353±0.06 g/cm3(Predicted) |
Melting Point | |
Melting Point | 188-190 °C |
Boiling Point | |
Boiling Point | 677.7±55.0 °C(Predicted) |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C25H26N2O5/c28-23(26-13-6-12-22(26)24(29)30)21-11-5-14-27(21)25(31)32-15-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20/h1-4,7-10,20-22H,5-6,11-15H2,(H,29,30)/t21-,22-/m0/s1 |
InChI Key | |
InChI Key | VRAQFWSWKRNOGU-VXKWHMMOSA-N |
Canonical SMILES | |
Canonical SMILES | C1CC(N(C1)C(=O)C2CCCN2C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2