Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | (S)-1-((S)-1-(((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Pyrrolidine-2-Carbonyl)Pyrrolidine-2-Carboxylic Acid |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 98% (HPLC) |
| Density | |
| Density | 1.353±0.06 g/cm3(Predicted) |
| Melting Point | |
| Melting Point | 188-190 °C |
| Boiling Point | |
| Boiling Point | 677.7±55.0 °C(Predicted) |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C25H26N2O5/c28-23(26-13-6-12-22(26)24(29)30)21-11-5-14-27(21)25(31)32-15-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20/h1-4,7-10,20-22H,5-6,11-15H2,(H,29,30)/t21-,22-/m0/s1 |
| InChI Key | |
| InChI Key | VRAQFWSWKRNOGU-VXKWHMMOSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1CC(N(C1)C(=O)C2CCCN2C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
