Fmoc-Pro-Pro-Pro-OH (BAT-005327)
* For research use only

Category
Others
Catalog number
BAT-005327
CAS number
134303-96-1
Molecular Formula
C30H33N3O6
Molecular Weight
531.60
Fmoc-Pro-Pro-Pro-OH
Synonyms
FMOC-PRO-PRO-PRO-OH
Purity
≥ 95%
InChI
InChI=1S/C30H33N3O6/c34-27(32-16-7-14-26(32)29(36)37)24-12-5-15-31(24)28(35)25-13-6-17-33(25)30(38)39-18-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-4,8-11,23-26H,5-7,12-18H2,(H,36,37)/t24-,25-,26-/m0/s1
InChI Key
JYDDNDUWEXGYKC-GSDHBNRESA-N
Canonical SMILES
C1CC(N(C1)C(=O)C2CCCN2C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)N6CCCC6C(=O)O
Bio Calculators
Stock concentration: *
Desired final volume: *
Desired concentration: *

L

* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2

* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O c22h30n40
g/mol
g
Quick Inquiry
Verification code
Inquiry Basket