Fmoc-(R)-2-(aminomethyl)butanoic acid (BAT-008869)

Category
Fmoc-Amino Acids
Catalog number
BAT-008869
CAS number
1217711-57-3
Molecular Formula
C20H21NO4
Molecular Weight
339.4
Fmoc-(R)-2-(aminomethyl)butanoic acid
IUPAC Name
(2R)-2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]butanoic acid
Synonyms
(2R)-2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]butanoicacid; AmbotzFAA1758; CTK6B1521; MolPort-008-267-738; ZINC2540510; GS-0804
Purity
95%
InChI
InChI=1S/C20H21NO4/c1-2-13(19(22)23)11-21-20(24)25-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18H,2,11-12H2,1H3,(H,21,24)(H,22,23)/t13-/m1/s1
InChI Key
UIMPTCRXHVBHOO-CYBMUJFWSA-N
Canonical SMILES
CCC(CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O
Bio Calculators
Stock concentration: *
Desired final volume: *
Desired concentration: *

L

* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2

* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O c22h30n40
g/mol
g
Quick Inquiry
Verification code
Inquiry Basket