Inquiry Basket
Synonyms | |
---|---|
Synonyms | N-Methyl-D-valine hydrochloride; (2R)-3-methyl-2-(methylamino)butanoic acid hydrochloride |
Appearance | |
Appearance | White to off-white powder |
Purity | |
Purity | ≥ 98% (TLC) |
Boiling Point | |
Boiling Point | 217.7ºC at 760 mmHg |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C6H13NO2.ClH/c1-4(2)5(7-3)6(8)9;/h4-5,7H,1-3H3,(H,8,9);1H/t5-;/m1./s1 |
InChI Key | |
InChI Key | LLAKGSVMNLYWAQ-NUBCRITNSA-N |
Canonical SMILES | |
Canonical SMILES | CC(C)C(C(=O)O)NC.Cl |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2