Inquiry Basket
Synonyms | |
---|---|
Synonyms | L-Bip(4,4')-OH; H-L-Ala(4,4'-biphenyl)-OH; (S)-2-Amino-3-biphenyl-4-yl-propionic acid |
Appearance | |
Appearance | White to off-white powder |
Purity | |
Purity | ≥ 99.0% (HPLC) |
Density | |
Density | 1.2±0.1 g/cm3 |
Boiling Point | |
Boiling Point | 428.6±40.0 °C |
Storage | |
Storage | Store at 2-8°C |
InChI | |
InChI | InChI=1S/C15H15NO2/c16-14(15(17)18)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9,14H,10,16H2,(H,17,18)/t14-/m0/s1 |
InChI Key | |
InChI Key | JCZLABDVDPYLRZ-AWEZNQCLSA-N |
Canonical SMILES | |
Canonical SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(C(=O)O)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2