Inquiry Basket
HOOBt is a STAT5-SUMO protein-protein interaction inhibitor that suppresses SUMOylation of phosphorylated STAT5.
| IUPAC Name | |
|---|---|
| IUPAC Name | 3-hydroxy-1,2,3-benzotriazin-4-one |
| Synonyms | |
| Synonyms | 3-Hydroxy-1,2,3-benzotriazin-4(3H)-one; 3-hydroxy-3H-benzo[d][1,2,3]triazin-4-one; DHBT; oxohydroxybenzotriazole; 4-oxo-3,4-dihydro-3-hydroxy-1,2,3-benzotriazine; 3-Hydroxy-4-ketobenzotriazine; 3,4-Dihydro-3-hydroxy-4-oxo-1,2,3-benzotriazine; 1,2,3-Benzotriazin-4(3H)-one,3-hydroxy; 3,4-dihydro-3-hydroxy-4-keto-1,2,3-benzotriazine; 3-Hydroxy-3,4-dihydro-4-oxo-1,2,3-benzotriazine |
| Appearance | |
| Appearance | Off-white to White Crystalline Powder |
| Purity | |
| Purity | 98% (HPLC) |
| Density | |
| Density | 1.041 g/cm3 (Predicted) |
| Melting Point | |
| Melting Point | 184-189 °C |
| Boiling Point | |
| Boiling Point | 290.1 °C (Predicted) |
| Storage | |
| Storage | 2-8 °C |
| InChI | |
| InChI | InChI=1S/C7H5N3O2/c11-7-5-3-1-2-4-6(5)8-9-10(7)12/h1-4,12H |
| InChI Key | |
| InChI Key | HJBLUNHMOKFZQX-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)N(N=N2)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
