Inquiry Basket
| IUPAC Name | |
|---|---|
| IUPAC Name | 1-oxido-2-[(1,3,4-trimethyl-4,5-dihydroimidazol-1-ium-2-yl)sulfanyl]pyridin-1-ium;hexafluorophosphate |
| Synonyms | |
| Synonyms | HPTDP; S-(1-Oxo-2-pyridyl)-thio-1,3-dimethylpropyleneuronium hexafluorophosphate; S-(1-Oxo-2-pyridyl)-thio-1,3-dimethylpropyleneuronium hexafluorophosphate; 1,3,5-Trimethyl-2-[(1-oxo-1lambda~5~-pyridin-2-yl)sulfanyl]-4,5-dihydro-1H-imidazol-3-ium hexafluorophosphate |
| Appearance | |
| Appearance | Off-white to White Powder |
| Purity | |
| Purity | 97% (HPLC) |
| Melting Point | |
| Melting Point | 110-112 °C |
| InChI | |
| InChI | InChI=1S/C11H16N3OS.F6P/c1-9-8-12(2)11(13(9)3)16-10-6-4-5-7-14(10)15;1-7(2,3,4,5)6/h4-7,9H,8H2,1-3H3;/q+1;-1 |
| InChI Key | |
| InChI Key | CFDJAMIPRYPAGC-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | CC1C[N+](=C(N1C)SC2=CC=CC=[N+]2[O-])C.F[P-](F)(F)(F)(F)F |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
