Inquiry Basket
| IUPAC Name | |
|---|---|
| IUPAC Name | (2S)-2-amino-3-(2-chloro-4-fluorophenyl)propanoic acid |
| Synonyms | |
| Synonyms | L-Phe(2-Cl,4-F)-OH; (S)-2-Amino-2-chloro-4-fluorophenylpropionic acid; H-Phe(2-Cl,4-F)-OH; 2-Chloro-4-fluoro-L-phenylalanine |
| Density | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | |
| Boiling Point | 338.4±42.0 °C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C9H9ClFNO2/c10-7-4-6(11)2-1-5(7)3-8(12)9(13)14/h1-2,4,8H,3,12H2,(H,13,14)/t8-/m0/s1 |
| InChI Key | |
| InChI Key | BCUFAMXOPAUSIP-QMMMGPOBSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC(=C(C=C1F)Cl)CC(C(=O)O)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
Three to One Letter Converter: Pull down the menu to view the 3 to 1 conversion.
Enter Peptide Sequence in Box (use one letter code)
Length: Residues
Molecular Weight: g/mol
Molecular formula:
