Inquiry Basket
L-Cysteine is a non-essential amino acid that can be synthesized by the human body under normal physiological conditions if a sufficient quantity of methionine is available. L-Cysteine is commonly used as a precursor in the food and pharmaceutical industries. L-Cysteine is used as a processing aid for baking, as an additive in cigarettes, as well as in the preparation of meat flavours.
| IUPAC Name | |
|---|---|
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;hydrate;hydrochloride |
| Synonyms | |
| Synonyms | R)-2-Amino-3-mercaptopropanoic Acid Hydrochloride Hydrate; (R)-Cysteine Hydrochloride Hydrate; 2-Amino-3-mercaptopropionic Acid Hydrochloride Hydrate; Cystein Hydrochloride Hydrate; Cysteine Hydrochloride Hydrate; E 920 Hydrochloride Hydrate; Half-cystine Hydrochloride Hydrate; L-(+)-Cysteine Hydrochloride Hydrate; 3-Mercapto-L-alanine Hydrochloride Hydrate; L-Cys Hydrochloride Hydrate; NSC 8746 Hydrochloride Hydrate; Thioserine Hydrochloride Hydrate; β-Mercaptoalanine Hydrochloride Hydrate |
| Appearance | |
| Appearance | White to Off-White Solid |
| Purity | |
| Purity | 98% |
| Density | |
| Density | 1.54 g/cm3 |
| Melting Point | |
| Melting Point | 166-170°C |
| Boiling Point | |
| Boiling Point | 293.9ºC at 760 mmHg |
| Storage | |
| Storage | Store at -20°C Under inert atmosphere |
| Solubility | |
| Solubility | soluble in Aqueous Acid, DMSO, Methanol, Water |
| InChI | |
| InChI | InChI=1S/C3H7NO2S.ClH.H2O/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);1H;1H2/t2-;;/m0../s1 |
| InChI Key | |
| InChI Key | QIJRTFXNRTXDIP-JIZZDEOASA-N |
| Canonical SMILES | |
| Canonical SMILES | C(C(C(=O)O)N)S.O.Cl |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
