Inquiry Basket
Synonyms | |
---|---|
Synonyms | L-Glu(OtBu)-OtBu HCl; H-Glu(OtBu)-OtBu HCl; L-glutamic acid di-t-butyl ester hydrochloride; H-Glu(OtBu)-OtBu HCl; H-L-Glu(OtBu)-OtBu HCl; L-Glutamic acid di-tert butyl |
Appearance | |
Appearance | White to off-white powder |
Purity | |
Purity | ≥ 99% (HPLC) |
Density | |
Density | 1.02 g/cm3 |
Melting Point | |
Melting Point | 112-125 °C |
Boiling Point | |
Boiling Point | 311.1 °C at 760 mmHg |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C13H25NO4.ClH/c1-12(2,3)17-10(15)8-7-9(14)11(16)18-13(4,5)6;/h9H,7-8,14H2,1-6H3;1H/t9-;/m0./s1 |
InChI Key | |
InChI Key | LFEYMWCCUAOUKZ-FVGYRXGTSA-N |
Canonical SMILES | |
Canonical SMILES | CC(C)(C)OC(=O)CCC(C(=O)OC(C)(C)C)N.Cl |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2