Inquiry Basket
L-Tyrosine tert-butyl ester is a protected form of L-Tyrosine. L-Tyrosine is an essential amino acid that exhibits in vitro antioxidant and antiradical activities. L-Tyrosine is used as a precursor to synthesize catecholamines in human keratinocytes, and also for the synthesis of proteins and thyroid hormones.
| Synonyms | |
|---|---|
| Synonyms | L-Tyr-OtBu; H-Tyr-OtBu; tert-Butyl L-tyrosinate; L-tyrosine-COOBu-t; L-Tyrosine tert-butyl ester; t-butyl ester of tyrosine |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 99% (HPLC) |
| Density | |
| Density | 1.125±0.06 g/cm3 |
| Melting Point | |
| Melting Point | 138-145 °C |
| Boiling Point | |
| Boiling Point | 358.1±27.0 °C |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C13H19NO3/c1-13(2,3)17-12(16)11(14)8-9-4-6-10(15)7-5-9/h4-7,11,15H,8,14H2,1-3H3/t11-/m0/s1 |
| InChI Key | |
| InChI Key | DIGHFXIWRPMGSA-NSHDSACASA-N |
| Canonical SMILES | |
| Canonical SMILES | CC(C)(C)OC(=O)C(CC1=CC=C(C=C1)O)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
