Inquiry Basket
N-(9-Fluorenylmethoxycarbonyl)-2-(2-(2-(2-aminoethoxy)ethoxy)ethoxy)acetic acid (CAS# 139338-72-0) is a useful research chemical.
| IUPAC Name | |
|---|---|
| IUPAC Name | 2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]acetic acid |
| Synonyms | |
| Synonyms | Fmoc-AEEEA-OH; Fmoc-NH-PEG3-CH2COOH; 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13-tetraoxa-4-azapentadecan-15-oic acid; Fmoc-amino-PEG3-CH2COOH; 11-[(9-Fluorenylmethoxycarbonyl)amino]-3,6,9-trioxaundecanoic acid |
| Boiling Point | |
| Boiling Point | 658.9±50.0 ℃ (Predicted) |
| Storage | |
| Storage | Store at -20 ℃ |
| InChI | |
| InChI | InChI=1S/C23H27NO7/c25-22(26)16-30-14-13-29-12-11-28-10-9-24-23(27)31-15-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-8,21H,9-16H2,(H,24,27)(H,25,26) |
| InChI Key | |
| InChI Key | XNOJSAOJCBOZTA-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCC(=O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
Three to One Letter Converter: Pull down the menu to view the 3 to 1 conversion.
Enter Peptide Sequence in Box (use one letter code)
Length: Residues
Molecular Weight: g/mol
Molecular formula:
