Inquiry Basket
| IUPAC Name | |
|---|---|
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylnon-8-enoic acid |
| Synonyms | |
| Synonyms | Fmoc-D-(Me)Gly(Heptenyl)-OH; N-α-(9-Fluorenylmethoxycarbonyl)-α-(6-heptenyl)-L-alanine; (R)-N-Fmoc-2-(6'-heptenyl)alanine; (R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-methylnon-8-enoic acid |
| Density | |
| Density | 1.154±0.06 g/cm3(Predicted) |
| Boiling Point | |
| Boiling Point | 613.4±55.0°C(Predicted) |
| Storage | |
| Storage | Store at -20 °C |
| InChI | |
| InChI | InChI=1S/C25H29NO4/c1-3-4-5-6-11-16-25(2,23(27)28)26-24(29)30-17-22-20-14-9-7-12-18(20)19-13-8-10-15-21(19)22/h3,7-10,12-15,22H,1,4-6,11,16-17H2,2H3,(H,26,29)(H,27,28)/t25-/m1/s1 |
| InChI Key | |
| InChI Key | WSTJGDVRPQAMSC-RUZDIDTESA-N |
| Canonical SMILES | |
| Canonical SMILES | CC(CCCCCC=C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
Three to One Letter Converter: Pull down the menu to view the 3 to 1 conversion.
Enter Peptide Sequence in Box (use one letter code)
Length: Residues
Molecular Weight: g/mol
Molecular formula:
