Inquiry Basket
N-acetyl histamine is a histamine metabolite that can be used as a biomarker of histidine metabolism for anaphylactoid reactions.
IUPAC Name | |
---|---|
IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]acetamide |
Synonyms | |
Synonyms | N-Acetylhistamine; N-omega-Acetylhistamine; Acetylhistamine |
Appearance | |
Appearance | White to off-white powder |
Purity | |
Purity | ≥95% |
Density | |
Density | 1.153 g/cm3 |
Melting Point | |
Melting Point | 146-148°C |
Boiling Point | |
Boiling Point | 501.7ºC at 760 mmHg |
InChI | |
InChI | InChI=1S/C7H11N3O/c1-6(11)9-3-2-7-4-8-5-10-7/h4-5H,2-3H2,1H3,(H,8,10)(H,9,11) |
InChI Key | |
InChI Key | XJWPISBUKWZALE-UHFFFAOYSA-N |
Canonical SMILES | |
Canonical SMILES | CC(=O)NCCC1=CN=CN1 |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2