Inquiry Basket
N-Hydroxysulfosuccinimide Sodium Salt is a hydrophilic ligand for the preparation of active esters, which can be used for crosslinking agents.
| IUPAC Name | |
|---|---|
| IUPAC Name | sodium;1-hydroxy-2,5-dioxopyrrolidine-3-sulfonate |
| Synonyms | |
| Synonyms | Sulfo-NHS; 1-Hydroxy-2,5-dioxo-3-pyrrolidinesulfonic Acid Sodium Salt; Sodium N-Hydroxysulfosuccinimide; Sulfo-N-hydroxysuccinimide Sodium Salt; Hydroxy-2,5-dioxopyrrolidine-3-sulfonicacid sodium salt; 3-Pyrrolidinesulfonic acid, 1-hydroxy-2,5-dioxo-, monosodium salt; N-Hydroxy-2-(sodiosulfo)succinimide |
| Appearance | |
| Appearance | Off-white to White Powder |
| Purity | |
| Purity | 98% (HPLC) |
| Melting Point | |
| Melting Point | 250 °C (dec.) |
| Storage | |
| Storage | -20 °C under inert atmosphere |
| Solubility | |
| Solubility | Soluble in Methanol, Water |
| InChI | |
| InChI | InChI=1S/C4H5NO6S.Na/c6-3-1-2(12(9,10)11)4(7)5(3)8;/h2,8H,1H2,(H,9,10,11);/q;+1/p-1 |
| InChI Key | |
| InChI Key | RPENMORRBUTCPR-UHFFFAOYSA-M |
| Canonical SMILES | |
| Canonical SMILES | C1C(C(=O)N(C1=O)O)S(=O)(=O)[O-].[Na+] |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
