Inquiry Basket
Synonyms | |
---|---|
Synonyms | N-Me-L-Leu-OH HCl; H-NMe-Leu-OH; H-(ME)LEU-OH; N-ME-LEUCINE; N-ME-LEU-OH; L-N-Methylleucine |
Appearance | |
Appearance | White to off-white powder |
Purity | |
Purity | 98-102% (Assay by titration) |
Density | |
Density | 0.979±0.06 g/cm3 |
Melting Point | |
Melting Point | 300 °C |
Boiling Point | |
Boiling Point | 226.1±23.0 °C |
Storage | |
Storage | Store at 2-8 °C |
InChI | |
InChI | InChI=1S/C7H15NO2/c1-5(2)4-6(8-3)7(9)10/h5-6,8H,4H2,1-3H3,(H,9,10)/t6-/m0/s1 |
InChI Key | |
InChI Key | XJODGRWDFZVTKW-LURJTMIESA-N |
Canonical SMILES | |
Canonical SMILES | CC(C)CC(C(=O)O)NC |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2