Inquiry Basket
Activating reagent used in solid phase peptide synthesis.
| IUPAC Name | |
|---|---|
| IUPAC Name | diisopropylmethanediimine |
| Synonyms | |
| Synonyms | DIC; Diisopropylcarbodiimide; 1,3-diisopropylcarbodiimide; 2-Propanamine, N,N'-methanetetraylbis-; Diisopropylcarbodiimide; DIPCDI; diisopropyl-carbodiimid; DICI; DIPCI; N,N'-diisopropylcarb; DIC/DIPCDI; N,N'-di-iso-propylcarbodiimide; PCI; DIPC |
| Appearance | |
| Appearance | Colorless to yellow liquid |
| Purity | |
| Purity | ≥ 99% (Assay) |
| Density | |
| Density | 0.815 g/mL at 20 °C |
| Melting Point | |
| Melting Point | 210-212 °C (dec.) |
| Boiling Point | |
| Boiling Point | 145-148 °C |
| Storage | |
| Storage | Store at RT |
| Solubility | |
| Solubility | Slightly soluble in Chloroform, Methanol; Soluble in Methylene Chloride, Acetonitrile, Dioxane, Simethylformamide, Tetrahydrofuran |
| InChI | |
| InChI | InChI=1S/C7H14N2/c1-6(2)8-5-9-7(3)4/h6-7H,1-4H3 |
| InChI Key | |
| InChI Key | BDNKZNFMNDZQMI-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | CC(C)N=C=NC(C)C |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
