Inquiry Basket
Activating reagent used in solid phase peptide synthesis.
IUPAC Name | |
---|---|
IUPAC Name | diisopropylmethanediimine |
Synonyms | |
Synonyms | DIC; Diisopropylcarbodiimide; 1,3-diisopropylcarbodiimide; 2-Propanamine, N,N'-methanetetraylbis-; Diisopropylcarbodiimide; DIPCDI; diisopropyl-carbodiimid; DICI; DIPCI; N,N'-diisopropylcarb; DIC/DIPCDI; N,N'-di-iso-propylcarbodiimide; PCI; DIPC |
Appearance | |
Appearance | Colorless to yellow liquid |
Purity | |
Purity | ≥ 99% (Assay) |
Density | |
Density | 0.815 g/mL at 20 °C |
Melting Point | |
Melting Point | 210-212 °C (dec.) |
Boiling Point | |
Boiling Point | 145-148 °C |
Storage | |
Storage | Store at RT |
Solubility | |
Solubility | Slightly soluble in Chloroform, Methanol; Soluble in Methylene Chloride, Acetonitrile, Dioxane, Simethylformamide, Tetrahydrofuran |
InChI | |
InChI | InChI=1S/C7H14N2/c1-6(2)8-5-9-7(3)4/h6-7H,1-4H3 |
InChI Key | |
InChI Key | BDNKZNFMNDZQMI-UHFFFAOYSA-N |
Canonical SMILES | |
Canonical SMILES | CC(C)N=C=NC(C)C |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2