Inquiry Basket
| IUPAC Name | |
|---|---|
| IUPAC Name | [(6-chlorobenzotriazol-1-yl)oxy-(dimethylamino)methylidene]-dimethylazanium;tetrafluoroborate |
| Synonyms | |
| Synonyms | 1-[BIS(DIMETHYLAMINO)METHYLEN]-5-CHLOROBENZOTRIAZOLIUM 3-OXIDE TETRAFLUOROBORATE; 1-(BIS-DIMETHYLAMINO-METHYLENE)-5-CHLORO-3-OXY-1H-BENZOTRIAZOL-1-IUM TETRAFLUOROBORATE; TCTU; O-(6-Chloro-1-hydrocibenzotriazol-1-yl)- -1,1,3,3-tetramethyluroniumTetrafluoroborate; 1H-Benzotriazolium, 1-[bis(dimethylamino)methylene]-5-chloro-,tetrafluoroborate(1-), 3-oxide; TCTU; 1-(Bis-dimethylamino-methylene)-5-chloro-3-oxy-1H-benzotriazol-1-ium tetrafluoroborate; 1H-Benzotriazolium, 1-[bis(dimethylamino)methylene]-5-chloro-, 3-oxide tetrafluoroborate(1-) (1:1) |
| Appearance | |
| Appearance | Off-white to White Crystalline Powder |
| Purity | |
| Purity | 98% |
| Melting Point | |
| Melting Point | 201-205 °C |
| Storage | |
| Storage | RT |
| Solubility | |
| Solubility | Soluble in DMF |
| InChI | |
| InChI | InChI=1S/C11H15ClN5O.BF4/c1-15(2)11(16(3)4)18-17-10-7-8(12)5-6-9(10)13-14-17;2-1(3,4)5/h5-7H,1-4H3;/q+1;-1 |
| InChI Key | |
| InChI Key | GBGVQFJZGHBZMC-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | [B-](F)(F)(F)F.CN(C)C(=[N+](C)C)ON1C2=C(C=CC(=C2)Cl)N=N1 |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
