Inquiry Basket
Nim-Trityl-D-histidine is used as a reagent in solid-phase synthesis and screening of peptides as catalysts for asymmetric induction of desymmetrization of bis(phenol)s.
| Synonyms | |
|---|---|
| Synonyms | D-His(Trt)-OH; (2R)-2-amino-3-(1-tritylimidazol-4-yl)propanoic acid; Nim-Trityl-D-histidine; D-Histidine,1-(triphenylmethyl); H-D-His(Trt)-OH |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 99% (HPLC) |
| Density | |
| Density | 1.19 g/cm3 |
| Melting Point | |
| Melting Point | 218-223 °C |
| Boiling Point | |
| Boiling Point | 584.8±50.0 °C |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C25H23N3O2/c26-23(24(29)30)16-22-17-28(18-27-22)25(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,17-18,23H,16,26H2,(H,29,30)/t23-/m1/s1 |
| InChI Key | |
| InChI Key | BSZQZNOAYQCQFZ-HSZRJFAPSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)CC(C(=O)O)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
