Inquiry Basket
| IUPAC Name | |
|---|---|
| IUPAC Name | [(6-chlorobenzotriazol-1-yl)oxy-(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate |
| Synonyms | |
| Synonyms | HCTU; O-(6-Chloro-1-hydrocibenzotriazol-1-yl)- -1,1,3,3-tetramethyluroniumhexafluorophosphate; 2-(6-Chloro-1H-Benzo[D][1,2,3]Triazol-1-Yl)-1,1,3,3-Tetramethyluronium Hexafluorophosphate; 5-Chloro-1-[bis(dimethylamino)methyliumyl]-1H-benzotriazole-3-oxide hexafluorophosphate; 1-(Bis-dimethylamino-methylene)-5-chloro-3-oxy-1H-benzotriazol-1-ium hexafluorophosphate |
| Appearance | |
| Appearance | White to off-white crystalline powder |
| Purity | |
| Purity | ≥ 99% (HPLC) |
| Melting Point | |
| Melting Point | 185-190 °C |
| Storage | |
| Storage | Store at 2-8°C |
| InChI | |
| InChI | InChI=1S/C11H15ClN5O.F6P/c1-15(2)11(16(3)4)18-17-10-7-8(12)5-6-9(10)13-14-17;1-7(2,3,4,5)6/h5-7H,1-4H3;/q+1;-1 |
| InChI Key | |
| InChI Key | ZHHGTMQHUWDEJF-UHFFFAOYSA-N |
| Canonical SMILES | |
| Canonical SMILES | CN(C)C(=[N+](C)C)ON1C2=C(C=CC(=C2)Cl)N=N1.F[P-](F)(F)(F)(F)F |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
