Inquiry Basket
Coupling reagent for synthesis of peptide and the formation of other amides.
IUPAC Name | |
---|---|
IUPAC Name | [dimethylamino-(2,5-dioxopyrrolidin-1-yl)oxymethylidene]-dimethylazanium;hexafluorophosphate |
Synonyms | |
Synonyms | N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate; HSTU; O-(N-Succinimidyl)-1,1,3,3-tetramethyluronium hexafluorophosphate; AmbotzRL-1039; hexafluorophosphate |
Appearance | |
Appearance | White to off-white crystalline powder |
Purity | |
Purity | ≥ 99.5% (HPLC) |
Melting Point | |
Melting Point | 218-221 °C |
Storage | |
Storage | 2-8 °C |
Solubility | |
Solubility | Soluble in Acetonitrile (0.5 g/mL) |
InChI | |
InChI | InChI=1S/C9H16N3O3.F6P/c1-10(2)9(11(3)4)15-12-7(13)5-6-8(12)14;1-7(2,3,4,5)6/h5-6H2,1-4H3;/q+1;-1 |
InChI Key | |
InChI Key | STWZCCVNXFLDDD-UHFFFAOYSA-N |
Canonical SMILES | |
Canonical SMILES | CN(C)C(=[N+](C)C)ON1C(=O)CCC1=O.F[P-](F)(F)(F)(F)F |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2