Inquiry Basket
Phe-Phe-OH is used in the method and kit for assessing prognosis or risk of breast cancer using metabolic profiling.
| Synonyms | |
|---|---|
| Synonyms | Phe Phe OH |
| Appearance | |
| Appearance | White powder |
| Purity | |
| Purity | ≥ 98% (HPLC) |
| Density | |
| Density | 1.229 g/cm3 |
| Melting Point | |
| Melting Point | 288-290 °C |
| Boiling Point | |
| Boiling Point | 582.8°C |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C18H20N2O3/c19-15(11-13-7-3-1-4-8-13)17(21)20-16(18(22)23)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12,19H2,(H,20,21)(H,22,23)/t15-,16-/m0/s1 |
| InChI Key | |
| InChI Key | GKZIWHRNKRBEOH-HOTGVXAUSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)NC(CC2=CC=CC=C2)C(=O)O)N |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
