Inquiry Basket
| Synonyms | |
|---|---|
| Synonyms | L-Prolyl-L-tyrosine; Pro Tyr OH |
| Appearance | |
| Appearance | White to off-white powder |
| Purity | |
| Purity | ≥ 99% (Assay) |
| Density | |
| Density | 1.312 g/cm3 |
| Melting Point | |
| Melting Point | 205-210 °C |
| Boiling Point | |
| Boiling Point | 599.7°C at 760 mmHg |
| Storage | |
| Storage | Store at 2-8 °C |
| InChI | |
| InChI | InChI=1S/C14H18N2O4/c17-10-5-3-9(4-6-10)8-12(14(19)20)16-13(18)11-2-1-7-15-11/h3-6,11-12,15,17H,1-2,7-8H2,(H,16,18)(H,19,20)/t11-,12-/m0/s1 |
| InChI Key | |
| InChI Key | OIDKVWTWGDWMHY-RYUDHWBXSA-N |
| Canonical SMILES | |
| Canonical SMILES | C1CC(NC1)C(=O)NC(CC2=CC=C(C=C2)O)C(=O)O |
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
