(R)-2-acetoxypropanoic acid (BAT-009042)
* For research use only

Category
Others
Catalog number
BAT-009042
CAS number
18668-00-3
Molecular Formula
C5H8O4
Molecular Weight
132.11
(R)-2-acetoxypropanoic acid
IUPAC Name
(2R)-2-acetyloxypropanoic acid
Synonyms
(R)-(+)-2-Acetoxypropionic Acid; Propanoic acid, 2-(acetyloxy)-, (2R)-
InChI
InChI=1S/C5H8O4/c1-3(5(7)8)9-4(2)6/h3H,1-2H3,(H,7,8)/t3-/m1/s1
InChI Key
WTLNOANVTIKPEE-GSVOUGTGSA-N
Canonical SMILES
CC(C(=O)O)OC(=O)C
Bio Calculators
Stock concentration: *
Desired final volume: *
Desired concentration: *

L

* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2

* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O c22h30n40
g/mol
g
Quick Inquiry
Verification code
Inquiry Basket