(S)-3-[(t-Butoxycarbonyl)amino]pentanoic acid (BAT-003037)
* For research use only

Category
BOC-Amino Acids
Catalog number
BAT-003037
CAS number
183990-48-9
Molecular Formula
C10H19NO4
Molecular Weight
217.27
(S)-3-[(t-Butoxycarbonyl)amino]pentanoic acid
Synonyms
Boc-Ape(3)-OH; Boc-Abu(2)-(CCH2)OH; Pentanoic acid,3-[[(1,1-dimethylethoxy)carbonyl]amino]-,(3S)-(9CI)
Purity
≥ 95%
Density
1.081±0.060 g/cm3
Melting Point
88-89 °C
Boiling Point
353.0±25.0 °C
InChI
InChI=1S/C10H19NO4/c1-5-7(6-8(12)13)11-9(14)15-10(2,3)4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t7-/m0/s1
InChI Key
RJCHFHWEJSMOJW-ZETCQYMHSA-N
Canonical SMILES
CCC(CC(=O)O)NC(=O)OC(C)(C)C
Bio Calculators
Stock concentration: *
Desired final volume: *
Desired concentration: *

L

* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2

* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O c22h30n40
g/mol
g
Quick Inquiry
Verification code
Inquiry Basket